WS Intro 1 by 5w73VgGG

VIEWS: 81 PAGES: 2

									Name: ____________________________________                                           Organic Chemistry
                                                                                     Intro 1 Worksheet




1. Write the electron configuration for the following elements.
        a. C
        b. O
        c.   P
        d.   Cl
        e. K
2. For each compound state whether its bonding is ionic, covalent, or a mixture of ionic & covalent.
        a. NaCl
        b. CH3Li
        c.   CH2Cl2
        d. NaOCH3
        e. CF4
3. Draw the Lewis structure for each species.
        a. N2H4




        b. N2H2




        c.   CH3CHO




        d. CH3S(O)CH3




        e. CH3NCO


4. Draw the line angle formulas for the following
        a. CH3CHCHCH2CHCHCOOH


        b. NCCH2COCH2CHO


        c.   CH2CHCH(OH)CH2CO2H


        d. CH3CH(CH3)CH2C(CH2CH3)2CHO


        e. CH3CH2CH2CH2CH3
5. Draw the Lewis structures for
       a. Two compounds of the formula C4H10




       b. Two compounds for the formula C2H7N




       c.   Three compounds for the formula C3H8O2




6. Compound X, isolated from sheep’s wool fat has a pungent odor of dirty sweat socks. A careful analysis showed
   that X contained 62.0% carbon, 10.4% hydrogen, & oxygen.
       a. Compute the empirical formula for the compound.




       b. A molecular weight determination showed that the formula had a molecular weight of approximately 117
            g/mol. Find the molecular formula of X.


       c.   Draw 4 different possible structures for the compound X.




7. Assign formal charges to each element in the following compound




       a.
                                                                       c.



       b.



                                                                       d.




                                                                       e.

								
To top